C15H10BrN3O4S — CID 5090745
2-[(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-methoxy-6-nitrophenol (PubChem CID 5090745) has the molecular formula C15H10BrN3O4S and a molecular weight of 408.23 g/mol. Its IUPAC name is 2-[(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-methoxy-6-nitrophenol.
| Compound Name | 2-[(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 5090745 |
| Molecular Formula | C15H10BrN3O4S |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 2-[(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-methoxy-6-nitrophenol |
| SMILES | COc1cc(C=Nc2nc3ccc(Br)cc3s2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10BrN3O4S/c1-23-10-4-8(14(20)12(6-10)19(21)22)7-17-15-18-11-3-2-9(16)5-13(11)24-15/h2-7,20H,1H3 |
| InChIKey | VWOQJNPMKVPKBS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|