C16H16N2O4 — CID 791892
2-[(2,4-dimethylphenyl)iminomethyl]-4-methoxy-6-nitrophenol (PubChem CID 791892) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)iminomethyl]-4-methoxy-6-nitrophenol.
| Compound Name | 2-[(2,4-dimethylphenyl)iminomethyl]-4-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 791892 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)iminomethyl]-4-methoxy-6-nitrophenol |
| SMILES | COc1cc(/C=N/c2ccc(C)cc2C)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N2O4/c1-10-4-5-14(11(2)6-10)17-9-12-7-13(22-3)8-15(16(12)19)18(20)21/h4-9,19H,1-3H3/b17-9+ |
| InChIKey | SMSQNZRNOGJPGE-RQZCQDPDSA-N |
| XLogP | 3.68 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|