C16H16N2O3 — CID 902425
2-[(2,4-dimethylphenyl)iminomethyl]-6-methyl-4-nitrophenol (PubChem CID 902425) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)iminomethyl]-6-methyl-4-nitrophenol.
| Compound Name | 2-[(2,4-dimethylphenyl)iminomethyl]-6-methyl-4-nitrophenol |
|---|---|
| PubChem CID | 902425 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)iminomethyl]-6-methyl-4-nitrophenol |
| SMILES | Cc1ccc(/N=C/c2cc([N+](=O)[O-])cc(C)c2O)c(C)c1 |
| InChI | InChI=1S/C16H16N2O3/c1-10-4-5-15(11(2)6-10)17-9-13-8-14(18(20)21)7-12(3)16(13)19/h4-9,19H,1-3H3/b17-9+ |
| InChIKey | NGUCZPJIMCCELT-RQZCQDPDSA-N |
| XLogP | 3.98 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|