C25H26N2O — CID 137266730
2,6-bis[(2,4-dimethylphenyl)iminomethyl]-4-methylphenol (PubChem CID 137266730) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is 2,6-bis[(2,4-dimethylphenyl)iminomethyl]-4-methylphenol.
| Compound Name | 2,6-bis[(2,4-dimethylphenyl)iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 137266730 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2,6-bis[(2,4-dimethylphenyl)iminomethyl]-4-methylphenol |
| SMILES | Cc1ccc(/N=C/c2cc(C)cc(/C=N/c3ccc(C)cc3C)c2O)c(C)c1 |
| InChI | InChI=1S/C25H26N2O/c1-16-6-8-23(19(4)10-16)26-14-21-12-18(3)13-22(25(21)28)15-27-24-9-7-17(2)11-20(24)5/h6-15,28H,1-5H3/b26-14+,27-15+ |
| InChIKey | OAYLRGQAPWTLCU-CIOBDNPFSA-N |
| XLogP | 6.44 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|