C19H17NOS — CID 4682704
3-[(2,4-dimethylphenyl)iminomethyl]-5-phenylthiophen-2-ol (PubChem CID 4682704) has the molecular formula C19H17NOS and a molecular weight of 307.42 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)iminomethyl]-5-phenylthiophen-2-ol.
| Compound Name | 3-[(2,4-dimethylphenyl)iminomethyl]-5-phenylthiophen-2-ol |
|---|---|
| PubChem CID | 4682704 |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)iminomethyl]-5-phenylthiophen-2-ol |
| SMILES | Cc1ccc(/N=C/c2cc(-c3ccccc3)sc2O)c(C)c1 |
| InChI | InChI=1S/C19H17NOS/c1-13-8-9-17(14(2)10-13)20-12-16-11-18(22-19(16)21)15-6-4-3-5-7-15/h3-12,21H,1-2H3/b20-12+ |
| InChIKey | RALFGKPWQBXEKK-UDWIEESQSA-N |
| XLogP | 5.49 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|