About 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol
2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol (PubChem CID 136968910) has the molecular formula C22H19F2NO
and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol.
Molecular Properties
| Compound Name | 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol |
| PubChem CID | 136968910 |
| Molecular Formula | C22H19F2NO |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol |
| SMILES | Cc1cc(C(C)(F)F)ccc1/N=C/c1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C22H19F2NO/c1-15-13-18(22(2,23)24)11-12-20(15)25-14-17-9-6-10-19(21(17)26)16-7-4-3-5-8-16/h3-14,26H,1-2H3/b25-14+ |
| InChIKey | HZSZIDNLCSOQFZ-AFUMVMLFSA-N |
| XLogP | 6.23 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol?
The IUPAC name of 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol (CID 136968910) is 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol.
What is the SMILES notation for 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol?
The canonical SMILES for 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol is Cc1cc(C(C)(F)F)ccc1/N=C/c1cccc(-c2ccccc2)c1O.
What is the InChIKey of 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol?
The InChIKey is HZSZIDNLCSOQFZ-AFUMVMLFSA-N. The full InChI is InChI=1S/C22H19F2NO/c1-15-13-18(22(2,23)24)11-12-20(15)25-14-17-9-6-10-19(21(17)26)16-7-4-3-5-8-16/h3-14,26H,1-2H3/b25-14+.
What are the key properties of 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol?
2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol has a molecular weight of 351.40 g/mol, XLogP of 6.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(1,1-difluoroethyl)-2-methylphenyl]iminomethyl]-6-phenylphenol is sourced from PubChem (CID 136968910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).