C31H24Cl4NOPTi+ — CID 140560517
[5-chloro-2-[(2-hydroxy-3-phenylphenyl)methylideneamino]phenyl]-diphenylphosphanium;trichlorotitanium (PubChem CID 140560517) has the molecular formula C31H24Cl4NOPTi+ and a molecular weight of 647.19 g/mol. Its IUPAC name is [5-chloro-2-[(2-hydroxy-3-phenylphenyl)methylideneamino]phenyl]-diphenylphosphanium;trichlorotitanium.
| Compound Name | [5-chloro-2-[(2-hydroxy-3-phenylphenyl)methylideneamino]phenyl]-diphenylphosphanium;trichlorotitanium |
|---|---|
| PubChem CID | 140560517 |
| Molecular Formula | C31H24Cl4NOPTi+ |
| Molecular Weight | 647.19 g/mol |
| Exact Mass | 644.98 |
| IUPAC Name | [5-chloro-2-[(2-hydroxy-3-phenylphenyl)methylideneamino]phenyl]-diphenylphosphanium;trichlorotitanium |
| SMILES | Cl[Ti](Cl)Cl.Oc1c(/C=N/c2ccc(Cl)cc2[PH+](c2ccccc2)c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C31H23ClNOP.3ClH.Ti/c32-25-19-20-29(33-22-24-13-10-18-28(31(24)34)23-11-4-1-5-12-23)30(21-25)35(26-14-6-2-7-15-26)27-16-8-3-9-17-27;;;;/h1-22,34H;3*1H;/q;;;;+3/p-2/b33-22+;;;; |
| InChIKey | KIGMYQVQTNMPLU-SUNHTEQPSA-L |
| XLogP | 9.02 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.19 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|