C48H34N2O2 — CID 137098432
2-[[3-[(2-hydroxy-3,5-diphenylphenyl)methylideneamino]naphthalen-2-yl]iminomethyl]-4,6-diphenylphenol (PubChem CID 137098432) has the molecular formula C48H34N2O2 and a molecular weight of 670.81 g/mol. Its IUPAC name is 2-[[3-[(2-hydroxy-3,5-diphenylphenyl)methylideneamino]naphthalen-2-yl]iminomethyl]-4,6-diphenylphenol.
| Compound Name | 2-[[3-[(2-hydroxy-3,5-diphenylphenyl)methylideneamino]naphthalen-2-yl]iminomethyl]-4,6-diphenylphenol |
|---|---|
| PubChem CID | 137098432 |
| Molecular Formula | C48H34N2O2 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | 2-[[3-[(2-hydroxy-3,5-diphenylphenyl)methylideneamino]naphthalen-2-yl]iminomethyl]-4,6-diphenylphenol |
| SMILES | Oc1c(/C=N/c2cc3ccccc3cc2/N=C/c2cc(-c3ccccc3)cc(-c3ccccc3)c2O)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C48H34N2O2/c51-47-41(25-39(33-15-5-1-6-16-33)27-43(47)35-19-9-3-10-20-35)31-49-45-29-37-23-13-14-24-38(37)30-46(45)50-32-42-26-40(34-17-7-2-8-18-34)28-44(48(42)52)36-21-11-4-12-22-36/h1-32,51-52H/b49-31+,50-32+ |
| InChIKey | VPNPPUOSRMYZOV-OLWQKVGQSA-N |
| XLogP | 12.42 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|