C36H26N6O2 — CID 136823529
2-[[3-[(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]naphthalen-2-yl]iminomethyl]-4-phenyldiazenylphenol (PubChem CID 136823529) has the molecular formula C36H26N6O2 and a molecular weight of 574.64 g/mol. Its IUPAC name is 2-[[3-[(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]naphthalen-2-yl]iminomethyl]-4-phenyldiazenylphenol.
| Compound Name | 2-[[3-[(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]naphthalen-2-yl]iminomethyl]-4-phenyldiazenylphenol |
|---|---|
| PubChem CID | 136823529 |
| Molecular Formula | C36H26N6O2 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 2-[[3-[(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]naphthalen-2-yl]iminomethyl]-4-phenyldiazenylphenol |
| SMILES | Oc1ccc(/N=N/c2ccccc2)cc1/C=N/c1cc2ccccc2cc1/N=C/c1cc(/N=N/c2ccccc2)ccc1O |
| InChI | InChI=1S/C36H26N6O2/c43-35-17-15-31(41-39-29-11-3-1-4-12-29)19-27(35)23-37-33-21-25-9-7-8-10-26(25)22-34(33)38-24-28-20-32(16-18-36(28)44)42-40-30-13-5-2-6-14-30/h1-24,43-44H/b37-23+,38-24+,41-39+,42-40+ |
| InChIKey | FBDCGUFJUCECKO-YAJSAWQBSA-N |
| XLogP | 10.58 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|