C21H17N3O4 — CID 136901151
2-[[4-hydroxy-3-[(4-methoxyphenyl)iminomethyl]phenyl]diazenyl]benzoic acid (PubChem CID 136901151) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-[[4-hydroxy-3-[(4-methoxyphenyl)iminomethyl]phenyl]diazenyl]benzoic acid.
| Compound Name | 2-[[4-hydroxy-3-[(4-methoxyphenyl)iminomethyl]phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136901151 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-[[4-hydroxy-3-[(4-methoxyphenyl)iminomethyl]phenyl]diazenyl]benzoic acid |
| SMILES | COc1ccc(/N=C/c2cc(/N=N/c3ccccc3C(=O)O)ccc2O)cc1 |
| InChI | InChI=1S/C21H17N3O4/c1-28-17-9-6-15(7-10-17)22-13-14-12-16(8-11-20(14)25)23-24-19-5-3-2-4-18(19)21(26)27/h2-13,25H,1H3,(H,26,27)/b22-13+,24-23+ |
| InChIKey | NZNHJKOIVZHJQL-QTANEOQUSA-N |
| XLogP | 5.26 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|