C15H13ClN4O3 — CID 135783700
methyl N-[(Z)-[5-[(2-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]carbamate (PubChem CID 135783700) has the molecular formula C15H13ClN4O3 and a molecular weight of 332.75 g/mol. Its IUPAC name is methyl N-[(Z)-[5-[(2-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-[5-[(2-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 135783700 |
| Molecular Formula | C15H13ClN4O3 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | methyl N-[(Z)-[5-[(2-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]carbamate |
| SMILES | COC(=O)N/N=C\c1cc(/N=N/c2ccccc2Cl)ccc1O |
| InChI | InChI=1S/C15H13ClN4O3/c1-23-15(22)20-17-9-10-8-11(6-7-14(10)21)18-19-13-5-3-2-4-12(13)16/h2-9,21H,1H3,(H,20,22)/b17-9-,19-18+ |
| InChIKey | RZNFYNKPFDRLLU-QVSDVYIPSA-N |
| XLogP | 4.15 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|