C20H17ClN6O3S — CID 135858940
2-[4-[[5-[(2-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]phenyl]sulfonylguanidine (PubChem CID 135858940) has the molecular formula C20H17ClN6O3S and a molecular weight of 456.92 g/mol. Its IUPAC name is 2-[4-[[5-[(2-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[[5-[(2-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 135858940 |
| Molecular Formula | C20H17ClN6O3S |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 2-[4-[[5-[(2-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]phenyl]sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(/N=C/c2cc(/N=N/c3ccccc3Cl)ccc2O)cc1 |
| InChI | InChI=1S/C20H17ClN6O3S/c21-17-3-1-2-4-18(17)26-25-15-7-10-19(28)13(11-15)12-24-14-5-8-16(9-6-14)31(29,30)27-20(22)23/h1-12,28H,(H4,22,23,27)/b24-12+,26-25+ |
| InChIKey | SHFLGDMJAWQUPP-HDARYGDVSA-N |
| XLogP | 4.17 |
| TPSA | 155.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|