C18H16N4O3S — CID 3878912
2-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]sulfonylguanidine (PubChem CID 3878912) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 3878912 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(/N=C/c2c(O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c19-18(20)22-26(24,25)14-8-6-13(7-9-14)21-11-16-15-4-2-1-3-12(15)5-10-17(16)23/h1-11,23H,(H4,19,20,22)/b21-11+ |
| InChIKey | QLGGGBFSWGAKSF-SRZZPIQSSA-N |
| XLogP | 2.26 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|