C21H20N2O3S — CID 5178626
1-[(4-pyrrolidin-1-ylsulfonylphenyl)iminomethyl]naphthalen-2-ol (PubChem CID 5178626) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[(4-pyrrolidin-1-ylsulfonylphenyl)iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[(4-pyrrolidin-1-ylsulfonylphenyl)iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 5178626 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[(4-pyrrolidin-1-ylsulfonylphenyl)iminomethyl]naphthalen-2-ol |
| SMILES | O=S(=O)(c1ccc(/N=C/c2c(O)ccc3ccccc23)cc1)N1CCCC1 |
| InChI | InChI=1S/C21H20N2O3S/c24-21-12-7-16-5-1-2-6-19(16)20(21)15-22-17-8-10-18(11-9-17)27(25,26)23-13-3-4-14-23/h1-2,5-12,15,24H,3-4,13-14H2/b22-15+ |
| InChIKey | OZDGKEHMZXHXLM-PXLXIMEGSA-N |
| XLogP | 4.08 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|