C25H25N3O2S — CID 4570449
1-(9-ethylcarbazol-3-yl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanimine (PubChem CID 4570449) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-(9-ethylcarbazol-3-yl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanimine.
| Compound Name | 1-(9-ethylcarbazol-3-yl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanimine |
|---|---|
| PubChem CID | 4570449 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-(9-ethylcarbazol-3-yl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanimine |
| SMILES | CCn1c2ccccc2c2cc(/C=N/c3ccc(S(=O)(=O)N4CCCC4)cc3)ccc21 |
| InChI | InChI=1S/C25H25N3O2S/c1-2-28-24-8-4-3-7-22(24)23-17-19(9-14-25(23)28)18-26-20-10-12-21(13-11-20)31(29,30)27-15-5-6-16-27/h3-4,7-14,17-18H,2,5-6,15-16H2,1H3/b26-18+ |
| InChIKey | XLLPTQINUBTCAX-NLRVBDNBSA-N |
| XLogP | 5.35 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|