C17H17ClN2O2S — CID 969315
1-(4-chlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanimine (PubChem CID 969315) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanimine |
|---|---|
| PubChem CID | 969315 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)methanimine |
| SMILES | O=S(=O)(c1ccc(/N=C/c2ccc(Cl)cc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C17H17ClN2O2S/c18-15-5-3-14(4-6-15)13-19-16-7-9-17(10-8-16)23(21,22)20-11-1-2-12-20/h3-10,13H,1-2,11-12H2/b19-13+ |
| InChIKey | HEIKYKSNKMQEHI-CPNJWEJPSA-N |
| XLogP | 3.88 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|