C20H24N2O2S — CID 23941120
1-(2,4-dimethylphenyl)-N-(4-piperidin-1-ylsulfonylphenyl)methanimine (PubChem CID 23941120) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-N-(4-piperidin-1-ylsulfonylphenyl)methanimine.
| Compound Name | 1-(2,4-dimethylphenyl)-N-(4-piperidin-1-ylsulfonylphenyl)methanimine |
|---|---|
| PubChem CID | 23941120 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-N-(4-piperidin-1-ylsulfonylphenyl)methanimine |
| SMILES | Cc1ccc(/C=N/c2ccc(S(=O)(=O)N3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C20H24N2O2S/c1-16-6-7-18(17(2)14-16)15-21-19-8-10-20(11-9-19)25(23,24)22-12-4-3-5-13-22/h6-11,14-15H,3-5,12-13H2,1-2H3/b21-15+ |
| InChIKey | VCQCCOZIAUXJEM-RCCKNPSSSA-N |
| XLogP | 4.23 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|