C16H18N2O2S2 — CID 23819949
N-(4-piperidin-1-ylsulfonylphenyl)-1-thiophen-3-ylmethanimine (PubChem CID 23819949) has the molecular formula C16H18N2O2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is N-(4-piperidin-1-ylsulfonylphenyl)-1-thiophen-3-ylmethanimine.
| Compound Name | N-(4-piperidin-1-ylsulfonylphenyl)-1-thiophen-3-ylmethanimine |
|---|---|
| PubChem CID | 23819949 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-(4-piperidin-1-ylsulfonylphenyl)-1-thiophen-3-ylmethanimine |
| SMILES | O=S(=O)(c1ccc(/N=C/c2ccsc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C16H18N2O2S2/c19-22(20,18-9-2-1-3-10-18)16-6-4-15(5-7-16)17-12-14-8-11-21-13-14/h4-8,11-13H,1-3,9-10H2/b17-12+ |
| InChIKey | QQSWLCQOTVNGRB-SFQUDFHCSA-N |
| XLogP | 3.67 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|