C18H18Br2N2O3S — CID 135778678
2,4-dibromo-6-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]phenol (PubChem CID 135778678) has the molecular formula C18H18Br2N2O3S and a molecular weight of 502.23 g/mol. Its IUPAC name is 2,4-dibromo-6-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135778678 |
| Molecular Formula | C18H18Br2N2O3S |
| Molecular Weight | 502.23 g/mol |
| Exact Mass | 499.94 |
| IUPAC Name | 2,4-dibromo-6-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]phenol |
| SMILES | O=S(=O)(c1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1)N1CCCCC1 |
| InChI | InChI=1S/C18H18Br2N2O3S/c19-14-10-13(18(23)17(20)11-14)12-21-15-4-6-16(7-5-15)26(24,25)22-8-2-1-3-9-22/h4-7,10-12,23H,1-3,8-9H2/b21-12+ |
| InChIKey | GTOZNIIRJGAVSB-CIAFOILYSA-N |
| XLogP | 4.84 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.23 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|