C21H26BrN3O3S — CID 3360949
2-bromo-4-tert-butyl-6-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]phenol (PubChem CID 3360949) has the molecular formula C21H26BrN3O3S and a molecular weight of 480.43 g/mol. Its IUPAC name is 2-bromo-4-tert-butyl-6-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]phenol.
| Compound Name | 2-bromo-4-tert-butyl-6-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 3360949 |
| Molecular Formula | C21H26BrN3O3S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 2-bromo-4-tert-butyl-6-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]phenol |
| SMILES | CC(C)(C)c1cc(Br)c(O)c(/N=N/c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C21H26BrN3O3S/c1-21(2,3)15-13-18(22)20(26)19(14-15)24-23-16-7-9-17(10-8-16)29(27,28)25-11-5-4-6-12-25/h7-10,13-14,26H,4-6,11-12H2,1-3H3/b24-23+ |
| InChIKey | GHFFPOXNDMVYHN-WCWDXBQESA-N |
| XLogP | 6.04 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|