C14H18F3NO3S — CID 11681587
1,1,1-trifluoro-2-(4-piperidin-1-ylsulfonylphenyl)propan-2-ol (PubChem CID 11681587) has the molecular formula C14H18F3NO3S and a molecular weight of 337.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(4-piperidin-1-ylsulfonylphenyl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(4-piperidin-1-ylsulfonylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 11681587 |
| Molecular Formula | C14H18F3NO3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1,1,1-trifluoro-2-(4-piperidin-1-ylsulfonylphenyl)propan-2-ol |
| SMILES | CC(O)(c1ccc(S(=O)(=O)N2CCCCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO3S/c1-13(19,14(15,16)17)11-5-7-12(8-6-11)22(20,21)18-9-3-2-4-10-18/h5-8,19H,2-4,9-10H2,1H3 |
| InChIKey | TXRPNFMCZYROLC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |