C15H16F3NO4S — CID 21469116
1,1,1-trifluoro-2-methyl-4-(4-morpholin-4-ylsulfonylphenyl)but-3-yn-2-ol (PubChem CID 21469116) has the molecular formula C15H16F3NO4S and a molecular weight of 363.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-methyl-4-(4-morpholin-4-ylsulfonylphenyl)but-3-yn-2-ol.
| Compound Name | 1,1,1-trifluoro-2-methyl-4-(4-morpholin-4-ylsulfonylphenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 21469116 |
| Molecular Formula | C15H16F3NO4S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1,1,1-trifluoro-2-methyl-4-(4-morpholin-4-ylsulfonylphenyl)but-3-yn-2-ol |
| SMILES | CC(O)(C#Cc1ccc(S(=O)(=O)N2CCOCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO4S/c1-14(20,15(16,17)18)7-6-12-2-4-13(5-3-12)24(21,22)19-8-10-23-11-9-19/h2-5,20H,8-11H2,1H3 |
| InChIKey | MFKZADUKJAFUNM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|