C18H19N3O8S2 — CID 171983464
4-[[(4-morpholin-4-ylsulfonylbenzoyl)amino]sulfamoyl]benzoic acid (PubChem CID 171983464) has the molecular formula C18H19N3O8S2 and a molecular weight of 469.50 g/mol. Its IUPAC name is 4-[[(4-morpholin-4-ylsulfonylbenzoyl)amino]sulfamoyl]benzoic acid.
| Compound Name | 4-[[(4-morpholin-4-ylsulfonylbenzoyl)amino]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 171983464 |
| Molecular Formula | C18H19N3O8S2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 4-[[(4-morpholin-4-ylsulfonylbenzoyl)amino]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NNC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C18H19N3O8S2/c22-17(19-20-30(25,26)15-5-3-14(4-6-15)18(23)24)13-1-7-16(8-2-13)31(27,28)21-9-11-29-12-10-21/h1-8,20H,9-12H2,(H,19,22)(H,23,24) |
| InChIKey | TUDTVFOCPWTOMN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|