C18H26N2O5S — CID 110416759
N-[[1-(hydroxymethyl)cyclopentyl]methyl]-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 110416759) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclopentyl]methyl]-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 110416759 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCC1(CO)CCCC1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H26N2O5S/c21-14-18(7-1-2-8-18)13-19-17(22)15-3-5-16(6-4-15)26(23,24)20-9-11-25-12-10-20/h3-6,21H,1-2,7-14H2,(H,19,22) |
| InChIKey | VWMWSIMPDUCAGF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |