C18H25N3O5S — CID 112991295
N-(2-morpholin-4-yl-2-oxoethyl)-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 112991295) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-oxoethyl)-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2-morpholin-4-yl-2-oxoethyl)-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 112991295 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(2-morpholin-4-yl-2-oxoethyl)-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCC(=O)N1CCOCC1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25N3O5S/c22-17(20-10-12-26-13-11-20)14-19-18(23)15-4-6-16(7-5-15)27(24,25)21-8-2-1-3-9-21/h4-7H,1-3,8-14H2,(H,19,23) |
| InChIKey | YLXVZIRPWPMSMT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |