C23H29N3O6S2 — CID 110828401
1-(4-morpholin-4-ylsulfonylphenyl)-2-(4-piperidin-1-ylsulfonylanilino)ethanone (PubChem CID 110828401) has the molecular formula C23H29N3O6S2 and a molecular weight of 507.63 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylsulfonylphenyl)-2-(4-piperidin-1-ylsulfonylanilino)ethanone.
| Compound Name | 1-(4-morpholin-4-ylsulfonylphenyl)-2-(4-piperidin-1-ylsulfonylanilino)ethanone |
|---|---|
| PubChem CID | 110828401 |
| Molecular Formula | C23H29N3O6S2 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-(4-morpholin-4-ylsulfonylphenyl)-2-(4-piperidin-1-ylsulfonylanilino)ethanone |
| SMILES | O=C(CNc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H29N3O6S2/c27-23(19-4-8-21(9-5-19)34(30,31)26-14-16-32-17-15-26)18-24-20-6-10-22(11-7-20)33(28,29)25-12-2-1-3-13-25/h4-11,24H,1-3,12-18H2 |
| InChIKey | LYNAZRZXUXPWPP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |