C22H27N3O6S2 — CID 110828945
2-(4-morpholin-4-ylsulfonylanilino)-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110828945) has the molecular formula C22H27N3O6S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonylanilino)-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-(4-morpholin-4-ylsulfonylanilino)-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110828945 |
| Molecular Formula | C22H27N3O6S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonylanilino)-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | O=C(CNc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C22H27N3O6S2/c26-22(18-4-3-5-21(16-18)33(29,30)24-10-1-2-11-24)17-23-19-6-8-20(9-7-19)32(27,28)25-12-14-31-15-13-25/h3-9,16,23H,1-2,10-15,17H2 |
| InChIKey | ZLOATJFHYVKUQY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |