C19H18ClF3N2O3S — CID 110828967
2-[4-chloro-3-(trifluoromethyl)anilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110828967) has the molecular formula C19H18ClF3N2O3S and a molecular weight of 446.88 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)anilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)anilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110828967 |
| Molecular Formula | C19H18ClF3N2O3S |
| Molecular Weight | 446.88 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)anilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | O=C(CNc1ccc(Cl)c(C(F)(F)F)c1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H18ClF3N2O3S/c20-17-7-6-14(11-16(17)19(21,22)23)24-12-18(26)13-4-3-5-15(10-13)29(27,28)25-8-1-2-9-25/h3-7,10-11,24H,1-2,8-9,12H2 |
| InChIKey | FDINWKSCFUNERY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.88 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |