C19H18F3N3O5S — CID 110824505
2-[4-nitro-3-(trifluoromethyl)anilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110824505) has the molecular formula C19H18F3N3O5S and a molecular weight of 457.43 g/mol. Its IUPAC name is 2-[4-nitro-3-(trifluoromethyl)anilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[4-nitro-3-(trifluoromethyl)anilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110824505 |
| Molecular Formula | C19H18F3N3O5S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-[4-nitro-3-(trifluoromethyl)anilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | O=C(CNc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H18F3N3O5S/c20-19(21,22)16-11-14(6-7-17(16)25(27)28)23-12-18(26)13-4-3-5-15(10-13)31(29,30)24-8-1-2-9-24/h3-7,10-11,23H,1-2,8-9,12H2 |
| InChIKey | XWAGWPZKTBMUPF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|