C25H33N3O5S2 — CID 110828974
2-[4-(2-ethylpiperidin-1-yl)sulfonylanilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110828974) has the molecular formula C25H33N3O5S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 2-[4-(2-ethylpiperidin-1-yl)sulfonylanilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[4-(2-ethylpiperidin-1-yl)sulfonylanilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110828974 |
| Molecular Formula | C25H33N3O5S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 2-[4-(2-ethylpiperidin-1-yl)sulfonylanilino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(NCC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C25H33N3O5S2/c1-2-22-9-3-4-17-28(22)35(32,33)23-13-11-21(12-14-23)26-19-25(29)20-8-7-10-24(18-20)34(30,31)27-15-5-6-16-27/h7-8,10-14,18,22,26H,2-6,9,15-17,19H2,1H3 |
| InChIKey | DMSLDZCGEFZBFR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |