C19H18F3N3O6S — CID 110824776
1-(3-morpholin-4-ylsulfonylphenyl)-2-[2-nitro-4-(trifluoromethyl)anilino]ethanone (PubChem CID 110824776) has the molecular formula C19H18F3N3O6S and a molecular weight of 473.43 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylsulfonylphenyl)-2-[2-nitro-4-(trifluoromethyl)anilino]ethanone.
| Compound Name | 1-(3-morpholin-4-ylsulfonylphenyl)-2-[2-nitro-4-(trifluoromethyl)anilino]ethanone |
|---|---|
| PubChem CID | 110824776 |
| Molecular Formula | C19H18F3N3O6S |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 1-(3-morpholin-4-ylsulfonylphenyl)-2-[2-nitro-4-(trifluoromethyl)anilino]ethanone |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H18F3N3O6S/c20-19(21,22)14-4-5-16(17(11-14)25(27)28)23-12-18(26)13-2-1-3-15(10-13)32(29,30)24-6-8-31-9-7-24/h1-5,10-11,23H,6-9,12H2 |
| InChIKey | RNVHAOBQNIUNMV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|