C15H17N3O4S2 — CID 110824781
1-(3-morpholin-4-ylsulfonylphenyl)-2-(1,3-thiazol-2-ylamino)ethanone (PubChem CID 110824781) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylsulfonylphenyl)-2-(1,3-thiazol-2-ylamino)ethanone.
| Compound Name | 1-(3-morpholin-4-ylsulfonylphenyl)-2-(1,3-thiazol-2-ylamino)ethanone |
|---|---|
| PubChem CID | 110824781 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 1-(3-morpholin-4-ylsulfonylphenyl)-2-(1,3-thiazol-2-ylamino)ethanone |
| SMILES | O=C(CNc1nccs1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H17N3O4S2/c19-14(11-17-15-16-4-9-23-15)12-2-1-3-13(10-12)24(20,21)18-5-7-22-8-6-18/h1-4,9-10H,5-8,11H2,(H,16,17) |
| InChIKey | NFOVBABONGJNJD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |