C20H24N2O6S — CID 110824762
2-(2,5-dimethoxyanilino)-1-(3-morpholin-4-ylsulfonylphenyl)ethanone (PubChem CID 110824762) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-(2,5-dimethoxyanilino)-1-(3-morpholin-4-ylsulfonylphenyl)ethanone.
| Compound Name | 2-(2,5-dimethoxyanilino)-1-(3-morpholin-4-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110824762 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-(2,5-dimethoxyanilino)-1-(3-morpholin-4-ylsulfonylphenyl)ethanone |
| SMILES | COc1ccc(OC)c(NCC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C20H24N2O6S/c1-26-16-6-7-20(27-2)18(13-16)21-14-19(23)15-4-3-5-17(12-15)29(24,25)22-8-10-28-11-9-22/h3-7,12-13,21H,8-11,14H2,1-2H3 |
| InChIKey | CWRJTAYLBUZLAI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |