C20H25N3O7S2 — CID 5029544
3-(dimethylsulfamoyl)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 5029544) has the molecular formula C20H25N3O7S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 5029544 |
| Molecular Formula | C20H25N3O7S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C20H25N3O7S2/c1-22(2)31(25,26)16-6-4-5-15(13-16)20(24)21-18-14-17(7-8-19(18)29-3)32(27,28)23-9-11-30-12-10-23/h4-8,13-14H,9-12H2,1-3H3,(H,21,24) |
| InChIKey | NMCMQJIFCDRTOD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |