C18H21N3O7S2 — CID 24636022
N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-4-sulfamoylbenzamide (PubChem CID 24636022) has the molecular formula C18H21N3O7S2 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-4-sulfamoylbenzamide.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 24636022 |
| Molecular Formula | C18H21N3O7S2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-4-sulfamoylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21N3O7S2/c1-27-17-7-6-15(30(25,26)21-8-10-28-11-9-21)12-16(17)20-18(22)13-2-4-14(5-3-13)29(19,23)24/h2-7,12H,8-11H2,1H3,(H,20,22)(H2,19,23,24) |
| InChIKey | GNAOJTJZUQQOLJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |