C18H21N3O6S — CID 27283385
6-methoxy-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)pyridine-3-carboxamide (PubChem CID 27283385) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is 6-methoxy-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)pyridine-3-carboxamide.
| Compound Name | 6-methoxy-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 27283385 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 6-methoxy-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2OC)cn1 |
| InChI | InChI=1S/C18H21N3O6S/c1-25-16-5-4-14(28(23,24)21-7-9-27-10-8-21)11-15(16)20-18(22)13-3-6-17(26-2)19-12-13/h3-6,11-12H,7-10H2,1-2H3,(H,20,22) |
| InChIKey | PTDACBOJMJAAJM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |