C23H29N3O7S — CID 4521937
3,4-dimethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 4521937) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 4521937 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 3,4-dimethoxy-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2N2CCOCC2)cc1OC |
| InChI | InChI=1S/C23H29N3O7S/c1-30-21-6-3-17(15-22(21)31-2)23(27)24-19-16-18(34(28,29)26-9-13-33-14-10-26)4-5-20(19)25-7-11-32-12-8-25/h3-6,15-16H,7-14H2,1-2H3,(H,24,27) |
| InChIKey | OZMUKTJCPRZNCC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |