C20H25N3O7S2 — CID 24636024
4-(ethylsulfamoyl)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 24636024) has the molecular formula C20H25N3O7S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-(ethylsulfamoyl)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 4-(ethylsulfamoyl)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 24636024 |
| Molecular Formula | C20H25N3O7S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 4-(ethylsulfamoyl)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2OC)cc1 |
| InChI | InChI=1S/C20H25N3O7S2/c1-3-21-31(25,26)16-6-4-15(5-7-16)20(24)22-18-14-17(8-9-19(18)29-2)32(27,28)23-10-12-30-13-11-23/h4-9,14,21H,3,10-13H2,1-2H3,(H,22,24) |
| InChIKey | OSWYSELAJBBHPC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |