C24H24N2O5S — CID 4875043
N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-4-phenylbenzamide (PubChem CID 4875043) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-4-phenylbenzamide.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 4875043 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-4-phenylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O5S/c1-30-23-12-11-21(32(28,29)26-13-15-31-16-14-26)17-22(23)25-24(27)20-9-7-19(8-10-20)18-5-3-2-4-6-18/h2-12,17H,13-16H2,1H3,(H,25,27) |
| InChIKey | HMZKANDONONASV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |