C25H26N2O5S — CID 3594308
N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2,2-diphenylacetamide (PubChem CID 3594308) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2,2-diphenylacetamide.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3594308 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2,2-diphenylacetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O5S/c1-31-23-13-12-21(33(29,30)27-14-16-32-17-15-27)18-22(23)26-25(28)24(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-13,18,24H,14-17H2,1H3,(H,26,28) |
| InChIKey | MGWKNUJICZEBFO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |