C26H28N2O6S — CID 40789747
(2S)-N-(2-methoxy-5-methylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)-2-phenylacetamide (PubChem CID 40789747) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is (2S)-N-(2-methoxy-5-methylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)-2-phenylacetamide.
| Compound Name | (2S)-N-(2-methoxy-5-methylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)-2-phenylacetamide |
|---|---|
| PubChem CID | 40789747 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (2S)-N-(2-methoxy-5-methylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)-2-phenylacetamide |
| SMILES | COc1ccc(C)cc1NC(=O)[C@@H](Oc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O6S/c1-19-8-13-24(32-2)23(18-19)27-26(29)25(20-6-4-3-5-7-20)34-21-9-11-22(12-10-21)35(30,31)28-14-16-33-17-15-28/h3-13,18,25H,14-17H2,1-2H3,(H,27,29)/t25-/m0/s1 |
| InChIKey | WNOOJAYQERGDEL-VWLOTQADSA-N |
| XLogP | 3.78 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |