C22H20N2O5 — CID 2632132
(2S)-N-(2-methoxy-5-methylphenyl)-2-(4-nitrophenoxy)-2-phenylacetamide (PubChem CID 2632132) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is (2S)-N-(2-methoxy-5-methylphenyl)-2-(4-nitrophenoxy)-2-phenylacetamide.
| Compound Name | (2S)-N-(2-methoxy-5-methylphenyl)-2-(4-nitrophenoxy)-2-phenylacetamide |
|---|---|
| PubChem CID | 2632132 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (2S)-N-(2-methoxy-5-methylphenyl)-2-(4-nitrophenoxy)-2-phenylacetamide |
| SMILES | COc1ccc(C)cc1NC(=O)[C@@H](Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O5/c1-15-8-13-20(28-2)19(14-15)23-22(25)21(16-6-4-3-5-7-16)29-18-11-9-17(10-12-18)24(26)27/h3-14,21H,1-2H3,(H,23,25)/t21-/m0/s1 |
| InChIKey | NQBOSVAFMLHGKQ-NRFANRHFSA-N |
| XLogP | 4.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|