C26H27NO6 — CID 46603193
[2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(4-methoxyphenoxy)propanoate (PubChem CID 46603193) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(4-methoxyphenoxy)propanoate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(4-methoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 46603193 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(4-methoxyphenoxy)propanoate |
| SMILES | COc1ccc(OC(C)C(=O)OC(C(=O)Nc2cc(C)ccc2OC)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO6/c1-17-10-15-23(31-4)22(16-17)27-25(28)24(19-8-6-5-7-9-19)33-26(29)18(2)32-21-13-11-20(30-3)12-14-21/h5-16,18,24H,1-4H3,(H,27,28) |
| InChIKey | VJHLQUULAXZOCG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |