C26H27NO4 — CID 7984559
[(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-methyl-2-phenylpropanoate (PubChem CID 7984559) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-methyl-2-phenylpropanoate.
| Compound Name | [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 7984559 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-methyl-2-phenylpropanoate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](OC(=O)C(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c1-18-15-16-22(30-4)21(17-18)27-24(28)23(19-11-7-5-8-12-19)31-25(29)26(2,3)20-13-9-6-10-14-20/h5-17,23H,1-4H3,(H,27,28)/t23-/m1/s1 |
| InChIKey | LDJKOELOJRRFOD-HSZRJFAPSA-N |
| XLogP | 5.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |