C18H20N4O6 — CID 2954956
1-(2-methoxy-5-methylphenyl)-3-[2-(4-nitrophenoxy)propanoylamino]urea (PubChem CID 2954956) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-[2-(4-nitrophenoxy)propanoylamino]urea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-[2-(4-nitrophenoxy)propanoylamino]urea |
|---|---|
| PubChem CID | 2954956 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-[2-(4-nitrophenoxy)propanoylamino]urea |
| SMILES | COc1ccc(C)cc1NC(=O)NNC(=O)C(C)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N4O6/c1-11-4-9-16(27-3)15(10-11)19-18(24)21-20-17(23)12(2)28-14-7-5-13(6-8-14)22(25)26/h4-10,12H,1-3H3,(H,20,23)(H2,19,21,24) |
| InChIKey | TUJJAKYXYATMJM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|