C18H15N3O5 — CID 40812379
(2S)-N-(5-methyl-1,2-oxazol-3-yl)-2-(4-nitrophenoxy)-2-phenylacetamide (PubChem CID 40812379) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is (2S)-N-(5-methyl-1,2-oxazol-3-yl)-2-(4-nitrophenoxy)-2-phenylacetamide.
| Compound Name | (2S)-N-(5-methyl-1,2-oxazol-3-yl)-2-(4-nitrophenoxy)-2-phenylacetamide |
|---|---|
| PubChem CID | 40812379 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (2S)-N-(5-methyl-1,2-oxazol-3-yl)-2-(4-nitrophenoxy)-2-phenylacetamide |
| SMILES | Cc1cc(NC(=O)[C@@H](Oc2ccc([N+](=O)[O-])cc2)c2ccccc2)no1 |
| InChI | InChI=1S/C18H15N3O5/c1-12-11-16(20-26-12)19-18(22)17(13-5-3-2-4-6-13)25-15-9-7-14(8-10-15)21(23)24/h2-11,17H,1H3,(H,19,20,22)/t17-/m0/s1 |
| InChIKey | VMFSPJYEZNKXRJ-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|