C22H28N2O6S — CID 94016517
(2R)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-(3-methylphenoxy)butanamide (PubChem CID 94016517) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-(3-methylphenoxy)butanamide.
| Compound Name | (2R)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 94016517 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (2R)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-(3-methylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1cccc(C)c1)C(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1OC |
| InChI | InChI=1S/C22H28N2O6S/c1-4-20(30-17-7-5-6-16(2)14-17)22(25)23-19-15-18(8-9-21(19)28-3)31(26,27)24-10-12-29-13-11-24/h5-9,14-15,20H,4,10-13H2,1-3H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | CXUUUHVANUQWID-HXUWFJFHSA-N |
| XLogP | 2.82 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |