C25H26N2O6S — CID 40814254
(2S)-N-(3-methoxyphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)-2-phenylacetamide (PubChem CID 40814254) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is (2S)-N-(3-methoxyphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)-2-phenylacetamide.
| Compound Name | (2S)-N-(3-methoxyphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)-2-phenylacetamide |
|---|---|
| PubChem CID | 40814254 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (2S)-N-(3-methoxyphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)-2-phenylacetamide |
| SMILES | COc1cccc(NC(=O)[C@@H](Oc2ccc(S(=O)(=O)N3CCOCC3)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H26N2O6S/c1-31-22-9-5-8-20(18-22)26-25(28)24(19-6-3-2-4-7-19)33-21-10-12-23(13-11-21)34(29,30)27-14-16-32-17-15-27/h2-13,18,24H,14-17H2,1H3,(H,26,28)/t24-/m0/s1 |
| InChIKey | ARQIIYLQWHGCTM-DEOSSOPVSA-N |
| XLogP | 3.47 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |