C26H26N2O6S — CID 41000605
[(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 41000605) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 41000605 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1cccc(NC(=O)[C@H](OC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2O6S/c1-33-22-13-8-12-21(18-22)27-25(29)24(19-9-3-2-4-10-19)34-26(30)20-11-7-14-23(17-20)35(31,32)28-15-5-6-16-28/h2-4,7-14,17-18,24H,5-6,15-16H2,1H3,(H,27,29)/t24-/m1/s1 |
| InChIKey | JFHMRPYYXBTDTH-XMMPIXPASA-N |
| XLogP | 4.02 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |