C22H26N2O6S — CID 2545175
[2-(3-methoxyanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate (PubChem CID 2545175) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2545175 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
| SMILES | COc1cccc(NC(=O)COC(=O)c2cccc(S(=O)(=O)N3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C22H26N2O6S/c1-29-19-10-7-9-18(15-19)23-21(25)16-30-22(26)17-8-6-11-20(14-17)31(27,28)24-12-4-2-3-5-13-24/h6-11,14-15H,2-5,12-13,16H2,1H3,(H,23,25) |
| InChIKey | QGMGMTRWDVDLOZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |